About [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate
[4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate (PubChem CID 132821111) has the molecular formula C26H29N3O3
and a molecular weight of 431.54 g/mol. Its IUPAC name is [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate.
Molecular Properties
| Compound Name | [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate |
| PubChem CID | 132821111 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate |
| SMILES | CCCCCCC(C)Oc1ccc(C(=O)Oc2ccc(/N=N/c3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C26H29N3O3/c1-3-4-5-6-7-20(2)31-24-12-8-21(9-13-24)26(30)32-25-14-10-22(11-15-25)28-29-23-16-18-27-19-17-23/h8-20H,3-7H2,1-2H3/b29-28+ |
| InChIKey | QKHVRNYKFDCKFH-ZQHSETAFSA-N |
| XLogP | 7.45 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate?
The IUPAC name of [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate (CID 132821111) is [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate.
What is the SMILES notation for [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate?
The canonical SMILES for [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate is CCCCCCC(C)Oc1ccc(C(=O)Oc2ccc(/N=N/c3ccncc3)cc2)cc1.
What is the InChIKey of [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate?
The InChIKey is QKHVRNYKFDCKFH-ZQHSETAFSA-N. The full InChI is InChI=1S/C26H29N3O3/c1-3-4-5-6-7-20(2)31-24-12-8-21(9-13-24)26(30)32-25-14-10-22(11-15-25)28-29-23-16-18-27-19-17-23/h8-20H,3-7H2,1-2H3/b29-28+.
What are the key properties of [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate?
[4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate has a molecular weight of 431.54 g/mol, XLogP of 7.45, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(pyridin-4-yldiazenyl)phenyl] 4-octan-2-yloxybenzoate is sourced from PubChem (CID 132821111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).