C21H26N2O — CID 13283552
N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,3-diphenylpropan-2-imine (PubChem CID 13283552) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,3-diphenylpropan-2-imine.
| Compound Name | N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,3-diphenylpropan-2-imine |
|---|---|
| PubChem CID | 13283552 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,3-diphenylpropan-2-imine |
| SMILES | COC[C@@H]1CCCN1N=C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H26N2O/c1-24-17-21-13-8-14-23(21)22-20(15-18-9-4-2-5-10-18)16-19-11-6-3-7-12-19/h2-7,9-12,21H,8,13-17H2,1H3/t21-/m0/s1 |
| InChIKey | SCYYFRLKADYZSO-NRFANRHFSA-N |
| XLogP | 3.94 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|