C4H4N6O9 — CID 132837323
1-[(1-amino-2,2-dinitroethenyl)amino]-2,2-dinitroethenol (PubChem CID 132837323) has the molecular formula C4H4N6O9 and a molecular weight of 280.11 g/mol. Its IUPAC name is 1-[(1-amino-2,2-dinitroethenyl)amino]-2,2-dinitroethenol.
| Compound Name | 1-[(1-amino-2,2-dinitroethenyl)amino]-2,2-dinitroethenol |
|---|---|
| PubChem CID | 132837323 |
| Molecular Formula | C4H4N6O9 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 1-[(1-amino-2,2-dinitroethenyl)amino]-2,2-dinitroethenol |
| SMILES | NC(NC(O)=C([N+](=O)[O-])[N+](=O)[O-])=C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4H4N6O9/c5-1(3(7(12)13)8(14)15)6-2(11)4(9(16)17)10(18)19/h6,11H,5H2 |
| InChIKey | UOWZDGNPVXLBQW-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 230.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|