About [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium
[[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium (PubChem CID 132837853) has the molecular formula C35H31N3O2P+
and a molecular weight of 556.63 g/mol. Its IUPAC name is [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium.
Molecular Properties
| Compound Name | [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium |
| PubChem CID | 132837853 |
| Molecular Formula | C35H31N3O2P+ |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium |
| SMILES | c1ccc(COn2ccn(OCc3ccccc3)c2=N[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H31N3O2P/c1-6-16-30(17-7-1)28-39-37-26-27-38(40-29-31-18-8-2-9-19-31)35(37)36-41(32-20-10-3-11-21-32,33-22-12-4-13-23-33)34-24-14-5-15-25-34/h1-27H,28-29H2/q+1 |
| InChIKey | FTAODAFQXUIEPQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 40.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium?
The IUPAC name of [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium (CID 132837853) is [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium.
What is the SMILES notation for [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium?
The canonical SMILES for [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium is c1ccc(COn2ccn(OCc3ccccc3)c2=N[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium?
The InChIKey is FTAODAFQXUIEPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H31N3O2P/c1-6-16-30(17-7-1)28-39-37-26-27-38(40-29-31-18-8-2-9-19-31)35(37)36-41(32-20-10-3-11-21-32,33-22-12-4-13-23-33)34-24-14-5-15-25-34/h1-27H,28-29H2/q+1.
What are the key properties of [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium?
[[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium has a molecular weight of 556.63 g/mol, XLogP of 5.36, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[1,3-bis(phenylmethoxy)imidazol-2-ylidene]amino]-triphenylphosphanium is sourced from PubChem (CID 132837853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).