C19H21N2O+ — CID 20806995
1-benzyl-4,5-dimethyl-3-phenylmethoxyimidazol-1-ium (PubChem CID 20806995) has the molecular formula C19H21N2O+ and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-benzyl-4,5-dimethyl-3-phenylmethoxyimidazol-1-ium.
| Compound Name | 1-benzyl-4,5-dimethyl-3-phenylmethoxyimidazol-1-ium |
|---|---|
| PubChem CID | 20806995 |
| Molecular Formula | C19H21N2O+ |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-benzyl-4,5-dimethyl-3-phenylmethoxyimidazol-1-ium |
| SMILES | Cc1c(C)[n+](Cc2ccccc2)cn1OCc1ccccc1 |
| InChI | InChI=1S/C19H21N2O/c1-16-17(2)21(22-14-19-11-7-4-8-12-19)15-20(16)13-18-9-5-3-6-10-18/h3-12,15H,13-14H2,1-2H3/q+1 |
| InChIKey | STNOMJIIWKPCSB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|