C9H13N3O — CID 174937405
1-phenylmethoxy-1,2,4-triazolidine (PubChem CID 174937405) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-phenylmethoxy-1,2,4-triazolidine.
| Compound Name | 1-phenylmethoxy-1,2,4-triazolidine |
|---|---|
| PubChem CID | 174937405 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 1-phenylmethoxy-1,2,4-triazolidine |
| SMILES | c1ccc(CON2CNCN2)cc1 |
| InChI | InChI=1S/C9H13N3O/c1-2-4-9(5-3-1)6-13-12-8-10-7-11-12/h1-5,10-11H,6-8H2 |
| InChIKey | YMBGEZSYNSFVAN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |