About 1-phenylmethoxyindole-5,6-diol
1-phenylmethoxyindole-5,6-diol (PubChem CID 69255647) has the molecular formula C15H13NO3
and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-phenylmethoxyindole-5,6-diol.
Molecular Properties
| Compound Name | 1-phenylmethoxyindole-5,6-diol |
| PubChem CID | 69255647 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-phenylmethoxyindole-5,6-diol |
| SMILES | Oc1cc2ccn(OCc3ccccc3)c2cc1O |
| InChI | InChI=1S/C15H13NO3/c17-14-8-12-6-7-16(13(12)9-15(14)18)19-10-11-4-2-1-3-5-11/h1-9,17-18H,10H2 |
| InChIKey | LAZWNOLYEUNKJK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylmethoxyindole-5,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylmethoxyindole-5,6-diol?
The IUPAC name of 1-phenylmethoxyindole-5,6-diol (CID 69255647) is 1-phenylmethoxyindole-5,6-diol.
What is the SMILES notation for 1-phenylmethoxyindole-5,6-diol?
The canonical SMILES for 1-phenylmethoxyindole-5,6-diol is Oc1cc2ccn(OCc3ccccc3)c2cc1O.
What is the InChIKey of 1-phenylmethoxyindole-5,6-diol?
The InChIKey is LAZWNOLYEUNKJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3/c17-14-8-12-6-7-16(13(12)9-15(14)18)19-10-11-4-2-1-3-5-11/h1-9,17-18H,10H2.
What are the key properties of 1-phenylmethoxyindole-5,6-diol?
1-phenylmethoxyindole-5,6-diol has a molecular weight of 255.27 g/mol, XLogP of 2.68, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylmethoxyindole-5,6-diol is sourced from PubChem (CID 69255647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).