C30H38N6O8 — CID 132838608
1,10-bis(2-methoxyethyl)-4,7,13,16-tetrakis(prop-2-ynyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 132838608) has the molecular formula C30H38N6O8 and a molecular weight of 610.67 g/mol. Its IUPAC name is 1,10-bis(2-methoxyethyl)-4,7,13,16-tetrakis(prop-2-ynyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | 1,10-bis(2-methoxyethyl)-4,7,13,16-tetrakis(prop-2-ynyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 132838608 |
| Molecular Formula | C30H38N6O8 |
| Molecular Weight | 610.67 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | 1,10-bis(2-methoxyethyl)-4,7,13,16-tetrakis(prop-2-ynyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | C#CCN1CC(=O)N(CCOC)CC(=O)N(CC#C)CC(=O)N(CC#C)CC(=O)N(CCOC)CC(=O)N(CC#C)CC1=O |
| InChI | InChI=1S/C30H38N6O8/c1-7-11-31-19-25(37)33(13-9-3)21-30(42)36(16-18-44-6)24-28(40)32(12-8-2)20-26(38)34(14-10-4)22-29(41)35(15-17-43-5)23-27(31)39/h1-4H,11-24H2,5-6H3 |
| InChIKey | JPIUDLNKTKDKRR-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 140.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.67 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|