C30H46N6O10 — CID 139064634
1,4,10,13-tetrakis(2-methoxyethyl)-7,16-bis(prop-2-ynyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 139064634) has the molecular formula C30H46N6O10 and a molecular weight of 650.73 g/mol. Its IUPAC name is 1,4,10,13-tetrakis(2-methoxyethyl)-7,16-bis(prop-2-ynyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | 1,4,10,13-tetrakis(2-methoxyethyl)-7,16-bis(prop-2-ynyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 139064634 |
| Molecular Formula | C30H46N6O10 |
| Molecular Weight | 650.73 g/mol |
| Exact Mass | 650.33 |
| IUPAC Name | 1,4,10,13-tetrakis(2-methoxyethyl)-7,16-bis(prop-2-ynyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | C#CCN1CC(=O)N(CCOC)CC(=O)N(CCOC)CC(=O)N(CC#C)CC(=O)N(CCOC)CC(=O)N(CCOC)CC1=O |
| InChI | InChI=1S/C30H46N6O10/c1-7-9-31-19-27(39)35(13-17-45-5)23-30(42)34(12-16-44-4)22-26(38)32(10-8-2)20-28(40)36(14-18-46-6)24-29(41)33(11-15-43-3)21-25(31)37/h1-2H,9-24H2,3-6H3 |
| InChIKey | RFHKEFXYMPMEFV-UHFFFAOYSA-N |
| XLogP | -3.18 |
| TPSA | 158.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.73 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|