C21H16O4 — CID 132839453
(1R,13S)-16-methoxy-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2(11),4,6,8,14(19),15,17-heptaene-3,10-dione (PubChem CID 132839453) has the molecular formula C21H16O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is (1R,13S)-16-methoxy-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2(11),4,6,8,14(19),15,17-heptaene-3,10-dione.
| Compound Name | (1R,13S)-16-methoxy-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2(11),4,6,8,14(19),15,17-heptaene-3,10-dione |
|---|---|
| PubChem CID | 132839453 |
| Molecular Formula | C21H16O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (1R,13S)-16-methoxy-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2(11),4,6,8,14(19),15,17-heptaene-3,10-dione |
| SMILES | COc1ccc2c(c1)[C@H]1OC3=C(C(=O)c4ccccc4C3=O)[C@H]1CC2 |
| InChI | InChI=1S/C21H16O4/c1-24-12-8-6-11-7-9-15-17-18(22)13-4-2-3-5-14(13)19(23)21(17)25-20(15)16(11)10-12/h2-6,8,10,15,20H,7,9H2,1H3/t15-,20+/m1/s1 |
| InChIKey | GZFGYEOOFZKLEC-QRWLVFNGSA-N |
| XLogP | 3.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|