C9H15BrClNOS — CID 132893007
2-[(4-bromothiophen-2-yl)methylamino]butan-1-ol;hydrochloride (PubChem CID 132893007) has the molecular formula C9H15BrClNOS and a molecular weight of 300.65 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methylamino]butan-1-ol;hydrochloride.
| Compound Name | 2-[(4-bromothiophen-2-yl)methylamino]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 132893007 |
| Molecular Formula | C9H15BrClNOS |
| Molecular Weight | 300.65 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methylamino]butan-1-ol;hydrochloride |
| SMILES | CCC(CO)NCc1cc(Br)cs1.Cl |
| InChI | InChI=1S/C9H14BrNOS.ClH/c1-2-8(5-12)11-4-9-3-7(10)6-13-9;/h3,6,8,11-12H,2,4-5H2,1H3;1H |
| InChIKey | VQENOSFLOLYPAM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.65 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |