C6H6KN3O4 — CID 132933617
potassium 1,3-dimethyl-5-oxidoimino-1,3-diazinane-2,4,6-trione (PubChem CID 132933617) has the molecular formula C6H6KN3O4 and a molecular weight of 223.23 g/mol. Its IUPAC name is potassium 1,3-dimethyl-5-oxidoimino-1,3-diazinane-2,4,6-trione.
| Compound Name | potassium 1,3-dimethyl-5-oxidoimino-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 132933617 |
| Molecular Formula | C6H6KN3O4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | potassium 1,3-dimethyl-5-oxidoimino-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(=N[O-])C(=O)N(C)C1=O.[K+] |
| InChI | InChI=1S/C6H7N3O4.K/c1-8-4(10)3(7-13)5(11)9(2)6(8)12;/h13H,1-2H3;/q;+1/p-1 |
| InChIKey | NMVYBLZMUPLYQF-UHFFFAOYSA-M |
| XLogP | -4.02 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_sixes(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|