C7H8N3O3+ — CID 178100535
(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)-methylideneazanium (PubChem CID 178100535) has the molecular formula C7H8N3O3+ and a molecular weight of 182.16 g/mol. Its IUPAC name is (1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)-methylideneazanium.
| Compound Name | (1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)-methylideneazanium |
|---|---|
| PubChem CID | 178100535 |
| Molecular Formula | C7H8N3O3+ |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)-methylideneazanium |
| SMILES | C=[N+]=C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C7H8N3O3/c1-8-4-5(11)9(2)7(13)10(3)6(4)12/h1H2,2-3H3/q+1 |
| InChIKey | WYSHIQCGFARNDF-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_sixes(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|