C9H9N5O3 — CID 141291663
4-isocyano-1,3,9-trimethylpurine-2,6,8-trione (PubChem CID 141291663) has the molecular formula C9H9N5O3 and a molecular weight of 235.20 g/mol. Its IUPAC name is 4-isocyano-1,3,9-trimethylpurine-2,6,8-trione.
| Compound Name | 4-isocyano-1,3,9-trimethylpurine-2,6,8-trione |
|---|---|
| PubChem CID | 141291663 |
| Molecular Formula | C9H9N5O3 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 4-isocyano-1,3,9-trimethylpurine-2,6,8-trione |
| SMILES | [C-]#[N+]C12C(=NC(=O)N1C)C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C9H9N5O3/c1-10-9-5(11-7(16)13(9)3)6(15)12(2)8(17)14(9)4/h2-4H3 |
| InChIKey | YVKGDLSYWKPPGA-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 77.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|