C7H9N5O2 — CID 162518008
4-amino-1,3-dimethylpurine-2,6-dione (PubChem CID 162518008) has the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. Its IUPAC name is 4-amino-1,3-dimethylpurine-2,6-dione.
| Compound Name | 4-amino-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 162518008 |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 4-amino-1,3-dimethylpurine-2,6-dione |
| SMILES | CN1C(=O)C2=NC=NC2(N)N(C)C1=O |
| InChI | InChI=1S/C7H9N5O2/c1-11-5(13)4-7(8,10-3-9-4)12(2)6(11)14/h3H,8H2,1-2H3 |
| InChIKey | KFBRJTGCCLXYNG-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |