C6H8N3O4+ — CID 145260634
[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]oxidanium (PubChem CID 145260634) has the molecular formula C6H8N3O4+ and a molecular weight of 186.15 g/mol. Its IUPAC name is [(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]oxidanium.
| Compound Name | [(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]oxidanium |
|---|---|
| PubChem CID | 145260634 |
| Molecular Formula | C6H8N3O4+ |
| Molecular Weight | 186.15 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | [(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]oxidanium |
| SMILES | CN1C(=O)C(=N[OH2+])C(=O)N(C)C1=O |
| InChI | InChI=1S/C6H7N3O4/c1-8-4(10)3(7-13)5(11)9(2)6(8)12/h13H,1-2H3/p+1 |
| InChIKey | BVSCIXRAKUKIET-UHFFFAOYSA-O |
| XLogP | -1.88 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.15 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_sixes(27)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|