C16H19BF4O3 — CID 132938503
(3S)-4,4,4-trifluoro-1-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-one (PubChem CID 132938503) has the molecular formula C16H19BF4O3 and a molecular weight of 346.13 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-1-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-one.
| Compound Name | (3S)-4,4,4-trifluoro-1-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-one |
|---|---|
| PubChem CID | 132938503 |
| Molecular Formula | C16H19BF4O3 |
| Molecular Weight | 346.13 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (3S)-4,4,4-trifluoro-1-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-one |
| SMILES | CC1(C)OB([C@@H](CC(=O)c2ccc(F)cc2)C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C16H19BF4O3/c1-14(2)15(3,4)24-17(23-14)13(16(19,20)21)9-12(22)10-5-7-11(18)8-6-10/h5-8,13H,9H2,1-4H3/t13-/m0/s1 |
| InChIKey | NXYOTTGEYMZBBE-ZDUSSCGKSA-N |
| XLogP | 4.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.13 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|