C22H24N2O2 — CID 132938539
4-[2,5-bis(ethoxymethyl)-4-pyridin-4-ylphenyl]pyridine (PubChem CID 132938539) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-[2,5-bis(ethoxymethyl)-4-pyridin-4-ylphenyl]pyridine.
| Compound Name | 4-[2,5-bis(ethoxymethyl)-4-pyridin-4-ylphenyl]pyridine |
|---|---|
| PubChem CID | 132938539 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 4-[2,5-bis(ethoxymethyl)-4-pyridin-4-ylphenyl]pyridine |
| SMILES | CCOCc1cc(-c2ccncc2)c(COCC)cc1-c1ccncc1 |
| InChI | InChI=1S/C22H24N2O2/c1-3-25-15-19-13-22(18-7-11-24-12-8-18)20(16-26-4-2)14-21(19)17-5-9-23-10-6-17/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | BSISOCQIRZLWIV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |