C24H34O4 — CID 139792807
1,2,3,4-tetrakis(ethoxymethyl)-5-phenylbenzene (PubChem CID 139792807) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is 1,2,3,4-tetrakis(ethoxymethyl)-5-phenylbenzene.
| Compound Name | 1,2,3,4-tetrakis(ethoxymethyl)-5-phenylbenzene |
|---|---|
| PubChem CID | 139792807 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 1,2,3,4-tetrakis(ethoxymethyl)-5-phenylbenzene |
| SMILES | CCOCc1cc(-c2ccccc2)c(COCC)c(COCC)c1COCC |
| InChI | InChI=1S/C24H34O4/c1-5-25-15-20-14-21(19-12-10-9-11-13-19)23(17-27-7-3)24(18-28-8-4)22(20)16-26-6-2/h9-14H,5-8,15-18H2,1-4H3 |
| InChIKey | YANCFKLFFDKLSI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |