C28H24N4O — CID 139144971
ethanol;4-(2,4,5-tripyridin-4-ylphenyl)pyridine (PubChem CID 139144971) has the molecular formula C28H24N4O and a molecular weight of 432.53 g/mol. Its IUPAC name is ethanol;4-(2,4,5-tripyridin-4-ylphenyl)pyridine.
| Compound Name | ethanol;4-(2,4,5-tripyridin-4-ylphenyl)pyridine |
|---|---|
| PubChem CID | 139144971 |
| Molecular Formula | C28H24N4O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | ethanol;4-(2,4,5-tripyridin-4-ylphenyl)pyridine |
| SMILES | CCO.c1cc(-c2cc(-c3ccncc3)c(-c3ccncc3)cc2-c2ccncc2)ccn1 |
| InChI | InChI=1S/C26H18N4.C2H6O/c1-9-27-10-2-19(1)23-17-25(21-5-13-29-14-6-21)26(22-7-15-30-16-8-22)18-24(23)20-3-11-28-12-4-20;1-2-3/h1-18H;3H,2H2,1H3 |
| InChIKey | QBEVYCGDWYWEGD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |