C32H27ClO2P2 — CID 132942198
1-[1,2-bis(diphenylphosphoryl)ethyl]-4-chlorobenzene (PubChem CID 132942198) has the molecular formula C32H27ClO2P2 and a molecular weight of 540.97 g/mol. Its IUPAC name is 1-[1,2-bis(diphenylphosphoryl)ethyl]-4-chlorobenzene.
| Compound Name | 1-[1,2-bis(diphenylphosphoryl)ethyl]-4-chlorobenzene |
|---|---|
| PubChem CID | 132942198 |
| Molecular Formula | C32H27ClO2P2 |
| Molecular Weight | 540.97 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 1-[1,2-bis(diphenylphosphoryl)ethyl]-4-chlorobenzene |
| SMILES | O=P(CC(c1ccc(Cl)cc1)P(=O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H27ClO2P2/c33-27-23-21-26(22-24-27)32(37(35,30-17-9-3-10-18-30)31-19-11-4-12-20-31)25-36(34,28-13-5-1-6-14-28)29-15-7-2-8-16-29/h1-24,32H,25H2 |
| InChIKey | QNXDNBXRIFUVIN-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.97 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|