C49H42O3P2 — CID 132942741
(2R)-2-diphenylphosphanyl-3-[3-[(2R)-2-diphenylphosphanyl-3-oxo-3-phenylpropyl]-5-methoxyphenyl]-1-phenylpropan-1-one (PubChem CID 132942741) has the molecular formula C49H42O3P2 and a molecular weight of 740.82 g/mol. Its IUPAC name is (2R)-2-diphenylphosphanyl-3-[3-[(2R)-2-diphenylphosphanyl-3-oxo-3-phenylpropyl]-5-methoxyphenyl]-1-phenylpropan-1-one.
| Compound Name | (2R)-2-diphenylphosphanyl-3-[3-[(2R)-2-diphenylphosphanyl-3-oxo-3-phenylpropyl]-5-methoxyphenyl]-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 132942741 |
| Molecular Formula | C49H42O3P2 |
| Molecular Weight | 740.82 g/mol |
| Exact Mass | 740.26 |
| IUPAC Name | (2R)-2-diphenylphosphanyl-3-[3-[(2R)-2-diphenylphosphanyl-3-oxo-3-phenylpropyl]-5-methoxyphenyl]-1-phenylpropan-1-one |
| SMILES | COc1cc(C[C@H](C(=O)c2ccccc2)P(c2ccccc2)c2ccccc2)cc(C[C@H](C(=O)c2ccccc2)P(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C49H42O3P2/c1-52-41-33-37(35-46(48(50)39-20-8-2-9-21-39)53(42-24-12-4-13-25-42)43-26-14-5-15-27-43)32-38(34-41)36-47(49(51)40-22-10-3-11-23-40)54(44-28-16-6-17-29-44)45-30-18-7-19-31-45/h2-34,46-47H,35-36H2,1H3/t46-,47-/m1/s1 |
| InChIKey | PZELKFIZJRZWIO-NZCKGYRVSA-N |
| XLogP | 9.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.82 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|