C24H31ClOP+ — CID 132943159
6-chloro-2,2-dipentyl-4-phenyl-1,2-benzoxaphosphinin-2-ium (PubChem CID 132943159) has the molecular formula C24H31ClOP+ and a molecular weight of 401.94 g/mol. Its IUPAC name is 6-chloro-2,2-dipentyl-4-phenyl-1,2-benzoxaphosphinin-2-ium.
| Compound Name | 6-chloro-2,2-dipentyl-4-phenyl-1,2-benzoxaphosphinin-2-ium |
|---|---|
| PubChem CID | 132943159 |
| Molecular Formula | C24H31ClOP+ |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 6-chloro-2,2-dipentyl-4-phenyl-1,2-benzoxaphosphinin-2-ium |
| SMILES | CCCCC[P+]1(CCCCC)C=C(c2ccccc2)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C24H31ClOP/c1-3-5-10-16-27(17-11-6-4-2)19-23(20-12-8-7-9-13-20)22-18-21(25)14-15-24(22)26-27/h7-9,12-15,18-19H,3-6,10-11,16-17H2,1-2H3/q+1 |
| InChIKey | NCJMZVPXGDLIGU-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|