C18H17ClNO3P — CID 11864695
(2S)-6-chloro-2-morpholin-4-yl-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide (PubChem CID 11864695) has the molecular formula C18H17ClNO3P and a molecular weight of 361.76 g/mol. Its IUPAC name is (2S)-6-chloro-2-morpholin-4-yl-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide.
| Compound Name | (2S)-6-chloro-2-morpholin-4-yl-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide |
|---|---|
| PubChem CID | 11864695 |
| Molecular Formula | C18H17ClNO3P |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | (2S)-6-chloro-2-morpholin-4-yl-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide |
| SMILES | O=[P@@]1(N2CCOCC2)C=C(c2ccccc2)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C18H17ClNO3P/c19-15-6-7-18-16(12-15)17(14-4-2-1-3-5-14)13-24(21,23-18)20-8-10-22-11-9-20/h1-7,12-13H,8-11H2/t24-/m0/s1 |
| InChIKey | CQNMFUIQWLDRSB-DEOSSOPVSA-N |
| XLogP | 4.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|