C14H9ClO3P- — CID 2221079
6-chloro-2-oxido-4-phenyl-1,2lambda5-benzoxaphosphinine 2-oxide (PubChem CID 2221079) has the molecular formula C14H9ClO3P- and a molecular weight of 291.65 g/mol. Its IUPAC name is 6-chloro-2-oxido-4-phenyl-1,2lambda5-benzoxaphosphinine 2-oxide.
| Compound Name | 6-chloro-2-oxido-4-phenyl-1,2lambda5-benzoxaphosphinine 2-oxide |
|---|---|
| PubChem CID | 2221079 |
| Molecular Formula | C14H9ClO3P- |
| Molecular Weight | 291.65 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 6-chloro-2-oxido-4-phenyl-1,2lambda5-benzoxaphosphinine 2-oxide |
| SMILES | O=P1([O-])C=C(c2ccccc2)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C14H10ClO3P/c15-11-6-7-14-12(8-11)13(9-19(16,17)18-14)10-4-2-1-3-5-10/h1-9H,(H,16,17)/p-1 |
| InChIKey | BDQBVHWHJNBDDE-UHFFFAOYSA-M |
| XLogP | 3.67 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.65 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|