C15H12ClN — CID 175842137
6-chloro-4-phenyl-1,2-dihydroquinoline (PubChem CID 175842137) has the molecular formula C15H12ClN and a molecular weight of 241.72 g/mol. Its IUPAC name is 6-chloro-4-phenyl-1,2-dihydroquinoline.
| Compound Name | 6-chloro-4-phenyl-1,2-dihydroquinoline |
|---|---|
| PubChem CID | 175842137 |
| Molecular Formula | C15H12ClN |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 6-chloro-4-phenyl-1,2-dihydroquinoline |
| SMILES | Clc1ccc2c(c1)C(c1ccccc1)=CCN2 |
| InChI | InChI=1S/C15H12ClN/c16-12-6-7-15-14(10-12)13(8-9-17-15)11-4-2-1-3-5-11/h1-8,10,17H,9H2 |
| InChIKey | ZGIOALMUKQCUAQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |