C16H14ClN — CID 57315459
3-(4-chloro-2-phenylphenyl)-2,5-dihydro-1H-pyrrole (PubChem CID 57315459) has the molecular formula C16H14ClN and a molecular weight of 255.75 g/mol. Its IUPAC name is 3-(4-chloro-2-phenylphenyl)-2,5-dihydro-1H-pyrrole.
| Compound Name | 3-(4-chloro-2-phenylphenyl)-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 57315459 |
| Molecular Formula | C16H14ClN |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 3-(4-chloro-2-phenylphenyl)-2,5-dihydro-1H-pyrrole |
| SMILES | Clc1ccc(C2=CCNC2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C16H14ClN/c17-14-6-7-15(13-8-9-18-11-13)16(10-14)12-4-2-1-3-5-12/h1-8,10,18H,9,11H2 |
| InChIKey | PRGSZGQDOVJQOB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |