C20H23N — CID 90702914
3-[2-(4-tert-butylphenyl)phenyl]-2,5-dihydro-1H-pyrrole (PubChem CID 90702914) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-[2-(4-tert-butylphenyl)phenyl]-2,5-dihydro-1H-pyrrole.
| Compound Name | 3-[2-(4-tert-butylphenyl)phenyl]-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 90702914 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 3-[2-(4-tert-butylphenyl)phenyl]-2,5-dihydro-1H-pyrrole |
| SMILES | CC(C)(C)c1ccc(-c2ccccc2C2=CCNC2)cc1 |
| InChI | InChI=1S/C20H23N/c1-20(2,3)17-10-8-15(9-11-17)18-6-4-5-7-19(18)16-12-13-21-14-16/h4-12,21H,13-14H2,1-3H3 |
| InChIKey | HKUSWOXBDFWYIO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |