C13H14Cl2O4 — CID 13295370
2-chloro-2-(4-chlorophenoxy)-1-(5-methyl-1,3-dioxan-5-yl)ethanone (PubChem CID 13295370) has the molecular formula C13H14Cl2O4 and a molecular weight of 305.16 g/mol. Its IUPAC name is 2-chloro-2-(4-chlorophenoxy)-1-(5-methyl-1,3-dioxan-5-yl)ethanone.
| Compound Name | 2-chloro-2-(4-chlorophenoxy)-1-(5-methyl-1,3-dioxan-5-yl)ethanone |
|---|---|
| PubChem CID | 13295370 |
| Molecular Formula | C13H14Cl2O4 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-chloro-2-(4-chlorophenoxy)-1-(5-methyl-1,3-dioxan-5-yl)ethanone |
| SMILES | CC1(C(=O)C(Cl)Oc2ccc(Cl)cc2)COCOC1 |
| InChI | InChI=1S/C13H14Cl2O4/c1-13(6-17-8-18-7-13)11(16)12(15)19-10-4-2-9(14)3-5-10/h2-5,12H,6-8H2,1H3 |
| InChIKey | BUWZBCBEPSGSCD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|