About 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole
3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole (PubChem CID 132967297) has the molecular formula C14H12Cl2F3NO
and a molecular weight of 338.16 g/mol. Its IUPAC name is 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole |
| PubChem CID | 132967297 |
| Molecular Formula | C14H12Cl2F3NO |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole |
| SMILES | CC(C)(C)c1cc(-c2c(Cl)cc(C(F)(F)F)cc2Cl)on1 |
| InChI | InChI=1S/C14H12Cl2F3NO/c1-13(2,3)11-6-10(21-20-11)12-8(15)4-7(5-9(12)16)14(17,18)19/h4-6H,1-3H3 |
| InChIKey | PXWRZXASHYIFJT-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole?
The IUPAC name of 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole (CID 132967297) is 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole.
What is the SMILES notation for 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole?
The canonical SMILES for 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole is CC(C)(C)c1cc(-c2c(Cl)cc(C(F)(F)F)cc2Cl)on1.
What is the InChIKey of 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole?
The InChIKey is PXWRZXASHYIFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2F3NO/c1-13(2,3)11-6-10(21-20-11)12-8(15)4-7(5-9(12)16)14(17,18)19/h4-6H,1-3H3.
What are the key properties of 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole?
3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole has a molecular weight of 338.16 g/mol, XLogP of 5.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1,2-oxazole is sourced from PubChem (CID 132967297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).