C24H19NO5S — CID 132968990
methyl 2-(5-methoxy-1,3-dioxoisoindol-2-yl)-2-phenyl-2-phenylsulfanylacetate (PubChem CID 132968990) has the molecular formula C24H19NO5S and a molecular weight of 433.49 g/mol. Its IUPAC name is methyl 2-(5-methoxy-1,3-dioxoisoindol-2-yl)-2-phenyl-2-phenylsulfanylacetate.
| Compound Name | methyl 2-(5-methoxy-1,3-dioxoisoindol-2-yl)-2-phenyl-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 132968990 |
| Molecular Formula | C24H19NO5S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | methyl 2-(5-methoxy-1,3-dioxoisoindol-2-yl)-2-phenyl-2-phenylsulfanylacetate |
| SMILES | COC(=O)C(Sc1ccccc1)(c1ccccc1)N1C(=O)c2ccc(OC)cc2C1=O |
| InChI | InChI=1S/C24H19NO5S/c1-29-17-13-14-19-20(15-17)22(27)25(21(19)26)24(23(28)30-2,16-9-5-3-6-10-16)31-18-11-7-4-8-12-18/h3-15H,1-2H3 |
| InChIKey | KZFOJYSPHSASSB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|