C30H26N4O4S — CID 132969179
N,N-dimethylformamide;[2-oxo-2-[[4-(4-phenylphenyl)-1,3-thiazol-2-yl]amino]ethyl] (Z)-2-cyano-3-phenylprop-2-enoate (PubChem CID 132969179) has the molecular formula C30H26N4O4S and a molecular weight of 538.63 g/mol. Its IUPAC name is N,N-dimethylformamide;[2-oxo-2-[[4-(4-phenylphenyl)-1,3-thiazol-2-yl]amino]ethyl] (Z)-2-cyano-3-phenylprop-2-enoate.
| Compound Name | N,N-dimethylformamide;[2-oxo-2-[[4-(4-phenylphenyl)-1,3-thiazol-2-yl]amino]ethyl] (Z)-2-cyano-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 132969179 |
| Molecular Formula | C30H26N4O4S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | N,N-dimethylformamide;[2-oxo-2-[[4-(4-phenylphenyl)-1,3-thiazol-2-yl]amino]ethyl] (Z)-2-cyano-3-phenylprop-2-enoate |
| SMILES | CN(C)C=O.N#C/C(=C/c1ccccc1)C(=O)OCC(=O)Nc1nc(-c2ccc(-c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C27H19N3O3S.C3H7NO/c28-16-23(15-19-7-3-1-4-8-19)26(32)33-17-25(31)30-27-29-24(18-34-27)22-13-11-21(12-14-22)20-9-5-2-6-10-20;1-4(2)3-5/h1-15,18H,17H2,(H,29,30,31);3H,1-2H3/b23-15-; |
| InChIKey | DQMSCVYFLHZEDP-HNALGXGESA-N |
| XLogP | 5.27 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|