C20H15N3O4S — CID 2357989
[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] (E)-2-cyano-3-phenylprop-2-enoate (PubChem CID 2357989) has the molecular formula C20H15N3O4S and a molecular weight of 393.42 g/mol. Its IUPAC name is [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] (E)-2-cyano-3-phenylprop-2-enoate.
| Compound Name | [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] (E)-2-cyano-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 2357989 |
| Molecular Formula | C20H15N3O4S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] (E)-2-cyano-3-phenylprop-2-enoate |
| SMILES | COc1ccc2nc(NC(=O)COC(=O)/C(C#N)=C/c3ccccc3)sc2c1 |
| InChI | InChI=1S/C20H15N3O4S/c1-26-15-7-8-16-17(10-15)28-20(22-16)23-18(24)12-27-19(25)14(11-21)9-13-5-3-2-4-6-13/h2-10H,12H2,1H3,(H,22,23,24)/b14-9+ |
| InChIKey | GIWPSMJRRJDCMH-NTEUORMPSA-N |
| XLogP | 3.39 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|