About 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol
1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol (PubChem CID 132969774) has the molecular formula C6H13N2O+
and a molecular weight of 129.18 g/mol. Its IUPAC name is 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol.
Molecular Properties
| Compound Name | 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol |
| PubChem CID | 132969774 |
| Molecular Formula | C6H13N2O+ |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol |
| SMILES | CC[N+]1=CN(C)C(O)C1 |
| InChI | InChI=1S/C6H13N2O/c1-3-8-4-6(9)7(2)5-8/h5-6,9H,3-4H2,1-2H3/q+1 |
| InChIKey | XYCNWAIRWKUQPG-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol?
The IUPAC name of 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol (CID 132969774) is 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol.
What is the SMILES notation for 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol?
The canonical SMILES for 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol is CC[N+]1=CN(C)C(O)C1.
What is the InChIKey of 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol?
The InChIKey is XYCNWAIRWKUQPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N2O/c1-3-8-4-6(9)7(2)5-8/h5-6,9H,3-4H2,1-2H3/q+1.
What are the key properties of 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol?
1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol has a molecular weight of 129.18 g/mol, XLogP of -0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol is sourced from PubChem (CID 132969774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).