C6H13N2O+ — CID 132969774
1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol (PubChem CID 132969774) has the molecular formula C6H13N2O+ and a molecular weight of 129.18 g/mol. Its IUPAC name is 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol.
| Compound Name | 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol |
|---|---|
| PubChem CID | 132969774 |
| Molecular Formula | C6H13N2O+ |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 1-ethyl-3-methyl-4,5-dihydroimidazol-1-ium-4-ol |
| SMILES | CC[N+]1=CN(C)C(O)C1 |
| InChI | InChI=1S/C6H13N2O/c1-3-8-4-6(9)7(2)5-8/h5-6,9H,3-4H2,1-2H3/q+1 |
| InChIKey | XYCNWAIRWKUQPG-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|