C21H30N2O4 — CID 132972452
3-(4-benzoyl-1,4-diazepane-1-carbonyl)-3,5-dimethylhexanoic acid (PubChem CID 132972452) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-(4-benzoyl-1,4-diazepane-1-carbonyl)-3,5-dimethylhexanoic acid.
| Compound Name | 3-(4-benzoyl-1,4-diazepane-1-carbonyl)-3,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 132972452 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 3-(4-benzoyl-1,4-diazepane-1-carbonyl)-3,5-dimethylhexanoic acid |
| SMILES | CC(C)CC(C)(CC(=O)O)C(=O)N1CCCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N2O4/c1-16(2)14-21(3,15-18(24)25)20(27)23-11-7-10-22(12-13-23)19(26)17-8-5-4-6-9-17/h4-6,8-9,16H,7,10-15H2,1-3H3,(H,24,25) |
| InChIKey | FSGUECNZJLRGHM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |