C16H20F3NO5S — CID 132972742
2-[4-hydroxy-1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-2-methylpropanoic acid (PubChem CID 132972742) has the molecular formula C16H20F3NO5S and a molecular weight of 395.40 g/mol. Its IUPAC name is 2-[4-hydroxy-1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-2-methylpropanoic acid.
| Compound Name | 2-[4-hydroxy-1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 132972742 |
| Molecular Formula | C16H20F3NO5S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-[4-hydroxy-1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)C1(O)CCN(S(=O)(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H20F3NO5S/c1-14(2,13(21)22)15(23)7-9-20(10-8-15)26(24,25)12-6-4-3-5-11(12)16(17,18)19/h3-6,23H,7-10H2,1-2H3,(H,21,22) |
| InChIKey | MRBRPJKFYUOSBA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |