C23H18F3NO3S — CID 67358907
3,3-diphenyl-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-one (PubChem CID 67358907) has the molecular formula C23H18F3NO3S and a molecular weight of 445.46 g/mol. Its IUPAC name is 3,3-diphenyl-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-one.
| Compound Name | 3,3-diphenyl-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-one |
|---|---|
| PubChem CID | 67358907 |
| Molecular Formula | C23H18F3NO3S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 3,3-diphenyl-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-one |
| SMILES | O=C1N(S(=O)(=O)c2ccccc2C(F)(F)F)CCC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H18F3NO3S/c24-23(25,26)19-13-7-8-14-20(19)31(29,30)27-16-15-22(21(27)28,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14H,15-16H2 |
| InChIKey | UZQXYAFVSPWBNQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |