C41H70NO9P — CID 133053164
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hexadec-9-enoyloxypropan-2-yl] 5-hydroxyicosa-6,8,11,14,17-pentaenoate (PubChem CID 133053164) has the molecular formula C41H70NO9P and a molecular weight of 751.98 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hexadec-9-enoyloxypropan-2-yl] 5-hydroxyicosa-6,8,11,14,17-pentaenoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hexadec-9-enoyloxypropan-2-yl] 5-hydroxyicosa-6,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 133053164 |
| Molecular Formula | C41H70NO9P |
| Molecular Weight | 751.98 g/mol |
| Exact Mass | 751.48 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hexadec-9-enoyloxypropan-2-yl] 5-hydroxyicosa-6,8,11,14,17-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CC=CC(O)CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C41H70NO9P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-30-38(43)31-29-33-41(45)51-39(37-50-52(46,47)49-35-34-42)36-48-40(44)32-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5,7,11,13-14,16-17,19,23,25,27,30,38-39,43H,3-4,6,8-10,12,15,18,20-22,24,26,28-29,31-37,42H2,1-2H3,(H,46,47) |
| InChIKey | SYSAUTIDYBPVAJ-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.98 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|