C43H78NO9P — CID 156965363
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxypropan-2-yl] (Z)-icos-11-enoate (PubChem CID 156965363) has the molecular formula C43H78NO9P and a molecular weight of 784.07 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxypropan-2-yl] (Z)-icos-11-enoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxypropan-2-yl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 156965363 |
| Molecular Formula | C43H78NO9P |
| Molecular Weight | 784.07 g/mol |
| Exact Mass | 783.54 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxypropan-2-yl] (Z)-icos-11-enoate |
| SMILES | CC/C=C/C/C=C/C=C/C(O)CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C43H78NO9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-26-31-35-43(47)53-41(39-52-54(48,49)51-37-36-44)38-50-42(46)34-30-27-23-25-29-33-40(45)32-28-24-21-10-8-6-4-2/h6,8,14-15,21,24,28,32,40-41,45H,3-5,7,9-13,16-20,22-23,25-27,29-31,33-39,44H2,1-2H3,(H,48,49)/b8-6+,15-14-,24-21+,32-28+/t40?,41-/m1/s1 |
| InChIKey | OBDNUYSSZPNCTM-PJCODNDQSA-N |
| XLogP | 10.91 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.07 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|