C43H70NO9P — CID 156965083
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropyl] (5Z,8Z,11Z,13E,15R)-15-hydroxyicosa-5,8,11,13-tetraenoate (PubChem CID 156965083) has the molecular formula C43H70NO9P and a molecular weight of 776.00 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropyl] (5Z,8Z,11Z,13E,15R)-15-hydroxyicosa-5,8,11,13-tetraenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropyl] (5Z,8Z,11Z,13E,15R)-15-hydroxyicosa-5,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 156965083 |
| Molecular Formula | C43H70NO9P |
| Molecular Weight | 776.00 g/mol |
| Exact Mass | 775.48 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropyl] (5Z,8Z,11Z,13E,15R)-15-hydroxyicosa-5,8,11,13-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C=C\[C@H](O)CCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C43H70NO9P/c1-3-5-7-8-9-10-11-12-13-14-17-21-24-27-31-35-43(47)53-41(39-52-54(48,49)51-37-36-44)38-50-42(46)34-30-26-23-20-18-15-16-19-22-25-29-33-40(45)32-28-6-4-2/h5,7,9-10,12-13,15-17,20-23,25,29,33,40-41,45H,3-4,6,8,11,14,18-19,24,26-28,30-32,34-39,44H2,1-2H3,(H,48,49)/b7-5-,10-9-,13-12-,16-15-,21-17-,23-20-,25-22-,33-29+/t40-,41-/m1/s1 |
| InChIKey | NYICLLDZVOWJRP-LVPSYVOHSA-N |
| XLogP | 10.02 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.00 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|