C45H76NO10P — CID 156965554
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxypropan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate (PubChem CID 156965554) has the molecular formula C45H76NO10P and a molecular weight of 822.07 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxypropan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxypropan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 156965554 |
| Molecular Formula | C45H76NO10P |
| Molecular Weight | 822.07 g/mol |
| Exact Mass | 821.52 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxypropan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
| SMILES | CCCCCCCC/C=C\C/C=C\C/C=C\CCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCC[C@H](O)/C=C/C=C\C/C=C\C=C\[C@H](O)CCCCC |
| InChI | InChI=1S/C45H76NO10P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-22-25-29-35-44(49)53-39-43(40-55-57(51,52)54-38-37-46)56-45(50)36-30-34-42(48)33-28-24-21-19-20-23-27-32-41(47)31-26-6-4-2/h12-13,15-16,18,20-24,27-28,32-33,41-43,47-48H,3-11,14,17,19,25-26,29-31,34-40,46H2,1-2H3,(H,51,52)/b13-12-,16-15-,22-18-,23-20-,24-21-,32-27+,33-28+/t41-,42-,43-/m1/s1 |
| InChIKey | RKWQSZBUEWRJPA-DSXYQGGZSA-N |
| XLogP | 9.99 |
| TPSA | 174.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.07 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|