C43H74NO9P — CID 133053217
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octadec-9-enoyloxypropan-2-yl] 5-hydroxyicosa-6,8,11,14,17-pentaenoate (PubChem CID 133053217) has the molecular formula C43H74NO9P and a molecular weight of 780.04 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octadec-9-enoyloxypropan-2-yl] 5-hydroxyicosa-6,8,11,14,17-pentaenoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octadec-9-enoyloxypropan-2-yl] 5-hydroxyicosa-6,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 133053217 |
| Molecular Formula | C43H74NO9P |
| Molecular Weight | 780.04 g/mol |
| Exact Mass | 779.51 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octadec-9-enoyloxypropan-2-yl] 5-hydroxyicosa-6,8,11,14,17-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CC=CC(O)CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C43H74NO9P/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-34-42(46)50-38-41(39-52-54(48,49)51-37-36-44)53-43(47)35-31-33-40(45)32-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h6,8,12,14,17-19,21,25,27,29,32,40-41,45H,3-5,7,9-11,13,15-16,20,22-24,26,28,30-31,33-39,44H2,1-2H3,(H,48,49) |
| InChIKey | PQXDHEJADJRXRI-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.04 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|