C45H74NO9P — CID 156987061
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxypropyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate (PubChem CID 156987061) has the molecular formula C45H74NO9P and a molecular weight of 804.06 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxypropyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxypropyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
|---|---|
| PubChem CID | 156987061 |
| Molecular Formula | C45H74NO9P |
| Molecular Weight | 804.06 g/mol |
| Exact Mass | 803.51 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxypropyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](COC(=O)CCCC(O)/C=C/C=C/C/C=C/CCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C45H74NO9P/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-32-36-45(49)55-43(41-54-56(50,51)53-39-38-46)40-52-44(48)37-33-35-42(47)34-31-29-27-25-23-21-16-14-12-10-8-6-4-2/h5,7,11,13,17-18,20-23,26-29,31,34,42-43,47H,3-4,6,8-10,12,14-16,19,24-25,30,32-33,35-41,46H2,1-2H3,(H,50,51)/b7-5-,13-11-,18-17-,22-20-,23-21+,28-26-,29-27+,34-31+/t42?,43-/m1/s1 |
| InChIKey | XAAIXBVHTBRFAZ-PKIFYIQDSA-N |
| XLogP | 10.80 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.06 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|