About 2-ethoxybut-2-enenitrile
2-ethoxybut-2-enenitrile (PubChem CID 133053724) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is 2-ethoxybut-2-enenitrile.
Molecular Properties
| Compound Name | 2-ethoxybut-2-enenitrile |
| PubChem CID | 133053724 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 2-ethoxybut-2-enenitrile |
| SMILES | CC=C(C#N)OCC |
| InChI | InChI=1S/C6H9NO/c1-3-6(5-7)8-4-2/h3H,4H2,1-2H3 |
| InChIKey | HPHUOJKREZFAPP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxybut-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxybut-2-enenitrile?
The IUPAC name of 2-ethoxybut-2-enenitrile (CID 133053724) is 2-ethoxybut-2-enenitrile.
What is the SMILES notation for 2-ethoxybut-2-enenitrile?
The canonical SMILES for 2-ethoxybut-2-enenitrile is CC=C(C#N)OCC.
What is the InChIKey of 2-ethoxybut-2-enenitrile?
The InChIKey is HPHUOJKREZFAPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO/c1-3-6(5-7)8-4-2/h3H,4H2,1-2H3.
What are the key properties of 2-ethoxybut-2-enenitrile?
2-ethoxybut-2-enenitrile has a molecular weight of 111.14 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybut-2-enenitrile is sourced from PubChem (CID 133053724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).