C7H9N3O3S2 — CID 133057498
2-methylsulfanyl-4-methylsulfonylpyrimidine-5-carboxamide (PubChem CID 133057498) has the molecular formula C7H9N3O3S2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-methylsulfanyl-4-methylsulfonylpyrimidine-5-carboxamide.
| Compound Name | 2-methylsulfanyl-4-methylsulfonylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 133057498 |
| Molecular Formula | C7H9N3O3S2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 2-methylsulfanyl-4-methylsulfonylpyrimidine-5-carboxamide |
| SMILES | CSc1ncc(C(N)=O)c(S(C)(=O)=O)n1 |
| InChI | InChI=1S/C7H9N3O3S2/c1-14-7-9-3-4(5(8)11)6(10-7)15(2,12)13/h3H,1-2H3,(H2,8,11) |
| InChIKey | GDGRJSLKIGDHMN-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |