C52H32N2S4 — CID 133065014
9-[4-[4-(3,6-dithiophen-2-ylcarbazol-9-yl)phenyl]phenyl]-3,6-dithiophen-2-ylcarbazole (PubChem CID 133065014) has the molecular formula C52H32N2S4 and a molecular weight of 813.11 g/mol. Its IUPAC name is 9-[4-[4-(3,6-dithiophen-2-ylcarbazol-9-yl)phenyl]phenyl]-3,6-dithiophen-2-ylcarbazole.
| Compound Name | 9-[4-[4-(3,6-dithiophen-2-ylcarbazol-9-yl)phenyl]phenyl]-3,6-dithiophen-2-ylcarbazole |
|---|---|
| PubChem CID | 133065014 |
| Molecular Formula | C52H32N2S4 |
| Molecular Weight | 813.11 g/mol |
| Exact Mass | 812.14 |
| IUPAC Name | 9-[4-[4-(3,6-dithiophen-2-ylcarbazol-9-yl)phenyl]phenyl]-3,6-dithiophen-2-ylcarbazole |
| SMILES | c1csc(-c2ccc3c(c2)c2cc(-c4cccs4)ccc2n3-c2ccc(-c3ccc(-n4c5ccc(-c6cccs6)cc5c5cc(-c6cccs6)ccc54)cc3)cc2)c1 |
| InChI | InChI=1S/C52H32N2S4/c1-5-49(55-25-1)35-13-21-45-41(29-35)42-30-36(50-6-2-26-56-50)14-22-46(42)53(45)39-17-9-33(10-18-39)34-11-19-40(20-12-34)54-47-23-15-37(51-7-3-27-57-51)31-43(47)44-32-38(16-24-48(44)54)52-8-4-28-58-52/h1-32H |
| InChIKey | YXYKLHCDPOPYRV-UHFFFAOYSA-N |
| XLogP | 16.46 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.11 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |