C24H28F2N2O4S — CID 133069885
(3S,8R)-9-(2,4-difluorophenyl)sulfonyl-14-methyl-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one (PubChem CID 133069885) has the molecular formula C24H28F2N2O4S and a molecular weight of 478.56 g/mol. Its IUPAC name is (3S,8R)-9-(2,4-difluorophenyl)sulfonyl-14-methyl-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one.
| Compound Name | (3S,8R)-9-(2,4-difluorophenyl)sulfonyl-14-methyl-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one |
|---|---|
| PubChem CID | 133069885 |
| Molecular Formula | C24H28F2N2O4S |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (3S,8R)-9-(2,4-difluorophenyl)sulfonyl-14-methyl-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one |
| SMILES | CN1CCCCN(S(=O)(=O)c2ccc(F)cc2F)[C@@H]2CCCC[C@@H]2Oc2ccccc2C1=O |
| InChI | InChI=1S/C24H28F2N2O4S/c1-27-14-6-7-15-28(33(30,31)23-13-12-17(25)16-19(23)26)20-9-3-5-11-22(20)32-21-10-4-2-8-18(21)24(27)29/h2,4,8,10,12-13,16,20,22H,3,5-7,9,11,14-15H2,1H3/t20-,22+/m1/s1 |
| InChIKey | SIDCIBATKPPDFP-IRLDBZIGSA-N |
| XLogP | 4.21 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |