C26H34N2O4S — CID 110062955
(3S,8R)-14-methyl-9-[(3-methylphenyl)methylsulfonyl]-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one (PubChem CID 110062955) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is (3S,8R)-14-methyl-9-[(3-methylphenyl)methylsulfonyl]-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one.
| Compound Name | (3S,8R)-14-methyl-9-[(3-methylphenyl)methylsulfonyl]-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one |
|---|---|
| PubChem CID | 110062955 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | (3S,8R)-14-methyl-9-[(3-methylphenyl)methylsulfonyl]-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one |
| SMILES | Cc1cccc(CS(=O)(=O)N2CCCCN(C)C(=O)c3ccccc3O[C@H]3CCCC[C@H]32)c1 |
| InChI | InChI=1S/C26H34N2O4S/c1-20-10-9-11-21(18-20)19-33(30,31)28-17-8-7-16-27(2)26(29)22-12-3-5-14-24(22)32-25-15-6-4-13-23(25)28/h3,5,9-12,14,18,23,25H,4,6-8,13,15-17,19H2,1-2H3/t23-,25+/m1/s1 |
| InChIKey | FXOZPFJUDPGCDZ-NOZRDPDXSA-N |
| XLogP | 4.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |