C37H37BN2O9 — CID 133080665
N-[6-(2,5-dioxopyrrol-1-yl)hexyl]-3,6'-dioxo-3'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[2-benzofuran-1,9'-8aH-xanthene]-5-carboxamide (PubChem CID 133080665) has the molecular formula C37H37BN2O9 and a molecular weight of 664.52 g/mol. Its IUPAC name is N-[6-(2,5-dioxopyrrol-1-yl)hexyl]-3,6'-dioxo-3'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[2-benzofuran-1,9'-8aH-xanthene]-5-carboxamide.
| Compound Name | N-[6-(2,5-dioxopyrrol-1-yl)hexyl]-3,6'-dioxo-3'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[2-benzofuran-1,9'-8aH-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 133080665 |
| Molecular Formula | C37H37BN2O9 |
| Molecular Weight | 664.52 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | N-[6-(2,5-dioxopyrrol-1-yl)hexyl]-3,6'-dioxo-3'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[2-benzofuran-1,9'-8aH-xanthene]-5-carboxamide |
| SMILES | CC1(C)OB(c2ccc3c(c2)OC2=CC(=O)C=CC2C32OC(=O)c3cc(C(=O)NCCCCCCN4C(=O)C=CC4=O)ccc32)OC1(C)C |
| InChI | InChI=1S/C37H37BN2O9/c1-35(2)36(3,4)49-38(48-35)23-10-13-27-29(20-23)46-30-21-24(41)11-14-28(30)37(27)26-12-9-22(19-25(26)34(45)47-37)33(44)39-17-7-5-6-8-18-40-31(42)15-16-32(40)43/h9-16,19-21,28H,5-8,17-18H2,1-4H3,(H,39,44) |
| InChIKey | XNTFFVXZFUHLLG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|