C20H11NO7 — CID 40649136
(3R,9'aS)-6'-hydroxy-6-nitrospiro[2-benzofuran-3,9'-9aH-xanthene]-1,3'-dione (PubChem CID 40649136) has the molecular formula C20H11NO7 and a molecular weight of 377.31 g/mol. Its IUPAC name is (3R,9'aS)-6'-hydroxy-6-nitrospiro[2-benzofuran-3,9'-9aH-xanthene]-1,3'-dione.
| Compound Name | (3R,9'aS)-6'-hydroxy-6-nitrospiro[2-benzofuran-3,9'-9aH-xanthene]-1,3'-dione |
|---|---|
| PubChem CID | 40649136 |
| Molecular Formula | C20H11NO7 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | (3R,9'aS)-6'-hydroxy-6-nitrospiro[2-benzofuran-3,9'-9aH-xanthene]-1,3'-dione |
| SMILES | O=C1C=C[C@H]2C(=C1)Oc1cc(O)ccc1[C@@]21OC(=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H11NO7/c22-11-2-5-15-17(8-11)27-18-9-12(23)3-6-16(18)20(15)14-4-1-10(21(25)26)7-13(14)19(24)28-20/h1-9,15,23H/t15-,20-/m0/s1 |
| InChIKey | CVEKAMUQOOINBG-YWZLYKJASA-N |
| XLogP | 2.75 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|